johnnatackett100 johnnatackett100

17-02-2017
Mathematics

contestada

write an algebraic expression for the following: the difference of 8 times a number and 10

Respuesta :

Sydneydials1 Sydneydials1

17-02-2017

(Difference *8) a+10

Answer Link

Otras preguntas

Tera buys 10 pencils for $1.99. About how much $ does each pencil cost?

What is inside the top of disneyland’s matterhorn bobsled coaster?.

Which of the following ordered pairs make this equation true?

Which diagram shows the resulting wave when they cross at point X? A straight line. A triangular crest. A rectangular crest. A triangular trough.

Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please

According to marketers, what happens when a frozen yogurt customer, radley, goes on social media promoting his preference about a yogurt shop’s service and flav

Which of these could you share online with the fewest possible negative consequences? O A. Pictures of classmates engaging in their right to free speech • B. Vi

What is the rule for the reflection? rx-axis (x, y) - (-x, y) ry-axis (x, y) (-x, y) rx-axis (x, y) - (x, y) ry-axis (x, y) (x, −y)

A farmer’s rectangular pen has an area of 2,700 square feet, and the width is 15 feet shorter than the length. Find the dimensions of the pen.

Christy buys a bag of cookies that contains 7 chocolate chip cookies, 4 peanut butter cookies, 7 sugar cookies and 4 oatmeal cookies. what is the probability th